C15H8ClN5 — CID 115944692
1-[(2-chloroquinolin-3-yl)methyl]imidazole-4,5-dicarbonitrile (PubChem CID 115944692) has the molecular formula C15H8ClN5 and a molecular weight of 293.72 g/mol. Its IUPAC name is 1-[(2-chloroquinolin-3-yl)methyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[(2-chloroquinolin-3-yl)methyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 115944692 |
| Molecular Formula | C15H8ClN5 |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-[(2-chloroquinolin-3-yl)methyl]imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(Cc2cc3ccccc3nc2Cl)c1C#N |
| InChI | InChI=1S/C15H8ClN5/c16-15-11(5-10-3-1-2-4-12(10)20-15)8-21-9-19-13(6-17)14(21)7-18/h1-5,9H,8H2 |
| InChIKey | SURKFIXSLNSCRI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|