C15H17ClN2 — CID 60669623
2-chloro-3-(piperidin-1-ylmethyl)quinoline (PubChem CID 60669623) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 2-chloro-3-(piperidin-1-ylmethyl)quinoline.
| Compound Name | 2-chloro-3-(piperidin-1-ylmethyl)quinoline |
|---|---|
| PubChem CID | 60669623 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-chloro-3-(piperidin-1-ylmethyl)quinoline |
| SMILES | Clc1nc2ccccc2cc1CN1CCCCC1 |
| InChI | InChI=1S/C15H17ClN2/c16-15-13(11-18-8-4-1-5-9-18)10-12-6-2-3-7-14(12)17-15/h2-3,6-7,10H,1,4-5,8-9,11H2 |
| InChIKey | UQOBOJLZNPMAFU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|