C16H19ClN2O — CID 62988336
4-[(2-chloroquinolin-3-yl)methyl]-2-methyl-1,4-oxazepane (PubChem CID 62988336) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is 4-[(2-chloroquinolin-3-yl)methyl]-2-methyl-1,4-oxazepane.
| Compound Name | 4-[(2-chloroquinolin-3-yl)methyl]-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 62988336 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-[(2-chloroquinolin-3-yl)methyl]-2-methyl-1,4-oxazepane |
| SMILES | CC1CN(Cc2cc3ccccc3nc2Cl)CCCO1 |
| InChI | InChI=1S/C16H19ClN2O/c1-12-10-19(7-4-8-20-12)11-14-9-13-5-2-3-6-15(13)18-16(14)17/h2-3,5-6,9,12H,4,7-8,10-11H2,1H3 |
| InChIKey | ZEHNDCCWJLLDID-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|