C18H23ClN2 — CID 63479216
2-chloro-3-[(4-propylpiperidin-1-yl)methyl]quinoline (PubChem CID 63479216) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 2-chloro-3-[(4-propylpiperidin-1-yl)methyl]quinoline.
| Compound Name | 2-chloro-3-[(4-propylpiperidin-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 63479216 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-chloro-3-[(4-propylpiperidin-1-yl)methyl]quinoline |
| SMILES | CCCC1CCN(Cc2cc3ccccc3nc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClN2/c1-2-5-14-8-10-21(11-9-14)13-16-12-15-6-3-4-7-17(15)20-18(16)19/h3-4,6-7,12,14H,2,5,8-11,13H2,1H3 |
| InChIKey | KAXWYYXDCMDVQW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|