C17H19ClN2O — CID 104511613
1-[(2-chloroquinolin-3-yl)methyl]-4-propylpyrrolidin-2-one (PubChem CID 104511613) has the molecular formula C17H19ClN2O and a molecular weight of 302.80 g/mol. Its IUPAC name is 1-[(2-chloroquinolin-3-yl)methyl]-4-propylpyrrolidin-2-one.
| Compound Name | 1-[(2-chloroquinolin-3-yl)methyl]-4-propylpyrrolidin-2-one |
|---|---|
| PubChem CID | 104511613 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[(2-chloroquinolin-3-yl)methyl]-4-propylpyrrolidin-2-one |
| SMILES | CCCC1CC(=O)N(Cc2cc3ccccc3nc2Cl)C1 |
| InChI | InChI=1S/C17H19ClN2O/c1-2-5-12-8-16(21)20(10-12)11-14-9-13-6-3-4-7-15(13)19-17(14)18/h3-4,6-7,9,12H,2,5,8,10-11H2,1H3 |
| InChIKey | INHGETAMNFICIW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|