C18H14ClN3OS — CID 7885759
3-[(2-chloroquinolin-3-yl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 7885759) has the molecular formula C18H14ClN3OS and a molecular weight of 355.85 g/mol. Its IUPAC name is 3-[(2-chloroquinolin-3-yl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(2-chloroquinolin-3-yl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7885759 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3-[(2-chloroquinolin-3-yl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncn(Cc3cc4ccccc4nc3Cl)c(=O)c2c1C |
| InChI | InChI=1S/C18H14ClN3OS/c1-10-11(2)24-17-15(10)18(23)22(9-20-17)8-13-7-12-5-3-4-6-14(12)21-16(13)19/h3-7,9H,8H2,1-2H3 |
| InChIKey | ZGVYHQKUOQKMIU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|