C11H18N10O2 — CID 102148000
2-[2-(6-aminopurin-9-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide (PubChem CID 102148000) has the molecular formula C11H18N10O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-[2-(6-aminopurin-9-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide.
| Compound Name | 2-[2-(6-aminopurin-9-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 102148000 |
| Molecular Formula | C11H18N10O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[2-(6-aminopurin-9-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide |
| SMILES | NNC(=O)CN(CCn1cnc2c(N)ncnc21)CC(=O)NN |
| InChI | InChI=1S/C11H18N10O2/c12-10-9-11(16-5-15-10)21(6-17-9)2-1-20(3-7(22)18-13)4-8(23)19-14/h5-6H,1-4,13-14H2,(H,18,22)(H,19,23)(H2,12,15,16) |
| InChIKey | JJJHHLLNLZUJLX-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 183.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|