C12H12N8O — CID 106909508
6-[(6-aminopurin-9-yl)methyl]pyridine-2-carbohydrazide (PubChem CID 106909508) has the molecular formula C12H12N8O and a molecular weight of 284.28 g/mol. Its IUPAC name is 6-[(6-aminopurin-9-yl)methyl]pyridine-2-carbohydrazide.
| Compound Name | 6-[(6-aminopurin-9-yl)methyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 106909508 |
| Molecular Formula | C12H12N8O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6-[(6-aminopurin-9-yl)methyl]pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cccc(Cn2cnc3c(N)ncnc32)n1 |
| InChI | InChI=1S/C12H12N8O/c13-10-9-11(16-5-15-10)20(6-17-9)4-7-2-1-3-8(18-7)12(21)19-14/h1-3,5-6H,4,14H2,(H,19,21)(H2,13,15,16) |
| InChIKey | WVVGLRMPOMQGDA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 137.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|