C11H9N7S — CID 115334201
9-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)purin-6-amine (PubChem CID 115334201) has the molecular formula C11H9N7S and a molecular weight of 271.31 g/mol. Its IUPAC name is 9-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)purin-6-amine.
| Compound Name | 9-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 115334201 |
| Molecular Formula | C11H9N7S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 9-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H9N7S/c12-9-8-10(14-5-13-9)18(6-15-8)4-7-3-17-1-2-19-11(17)16-7/h1-3,5-6H,4H2,(H2,12,13,14) |
| InChIKey | JSBWUSGIWJXGHP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |