C8H9N9 — CID 177370737
9-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]purin-6-amine (PubChem CID 177370737) has the molecular formula C8H9N9 and a molecular weight of 231.22 g/mol. Its IUPAC name is 9-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]purin-6-amine.
| Compound Name | 9-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 177370737 |
| Molecular Formula | C8H9N9 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 9-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]purin-6-amine |
| SMILES | Nc1n[nH]c(Cn2cnc3c(N)ncnc32)n1 |
| InChI | InChI=1S/C8H9N9/c9-6-5-7(12-2-11-6)17(3-13-5)1-4-14-8(10)16-15-4/h2-3H,1H2,(H2,9,11,12)(H3,10,14,15,16) |
| InChIKey | SXKLJBAWCHHPQN-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |