C11H9N7O2 — CID 102973944
4-[(6-aminopurin-9-yl)methyl]pyrimidine-5-carboxylic acid (PubChem CID 102973944) has the molecular formula C11H9N7O2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 4-[(6-aminopurin-9-yl)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(6-aminopurin-9-yl)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 102973944 |
| Molecular Formula | C11H9N7O2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-[(6-aminopurin-9-yl)methyl]pyrimidine-5-carboxylic acid |
| SMILES | Nc1ncnc2c1ncn2Cc1ncncc1C(=O)O |
| InChI | InChI=1S/C11H9N7O2/c12-9-8-10(16-4-15-9)18(5-17-8)2-7-6(11(19)20)1-13-3-14-7/h1,3-5H,2H2,(H,19,20)(H2,12,15,16) |
| InChIKey | NKZMUKRHLBLDEG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |