C15H14N8O — CID 167440311
9-[[2-methoxy-4-(2H-triazol-4-yl)phenyl]methyl]purin-6-amine (PubChem CID 167440311) has the molecular formula C15H14N8O and a molecular weight of 322.33 g/mol. Its IUPAC name is 9-[[2-methoxy-4-(2H-triazol-4-yl)phenyl]methyl]purin-6-amine.
| Compound Name | 9-[[2-methoxy-4-(2H-triazol-4-yl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 167440311 |
| Molecular Formula | C15H14N8O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 9-[[2-methoxy-4-(2H-triazol-4-yl)phenyl]methyl]purin-6-amine |
| SMILES | COc1cc(-c2cn[nH]n2)ccc1Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H14N8O/c1-24-12-4-9(11-5-20-22-21-11)2-3-10(12)6-23-8-19-13-14(16)17-7-18-15(13)23/h2-5,7-8H,6H2,1H3,(H2,16,17,18)(H,20,21,22) |
| InChIKey | VGPCCWZCWISLCN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |