C12H9ClFN5 — CID 172677263
9-[(2-chloro-6-fluorophenyl)methyl]purin-6-(15N)amine (PubChem CID 172677263) has the molecular formula C12H9ClFN5 and a molecular weight of 280.67 g/mol. Its IUPAC name is 9-[(2-chloro-6-fluorophenyl)methyl]purin-6-(15N)amine.
| Compound Name | 9-[(2-chloro-6-fluorophenyl)methyl]purin-6-(15N)amine |
|---|---|
| PubChem CID | 172677263 |
| Molecular Formula | C12H9ClFN5 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 9-[(2-chloro-6-fluorophenyl)methyl]purin-6-(15N)amine |
| SMILES | [15NH2]c1[15n]c[15n]c2c1ncn2Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H9ClFN5/c13-8-2-1-3-9(14)7(8)4-19-6-18-10-11(15)16-5-17-12(10)19/h1-3,5-6H,4H2,(H2,15,16,17)/i15+1,16+1,17+1 |
| InChIKey | NAPNOSFRRMHNBJ-ZSHVCEJHSA-N |
| XLogP | 2.25 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |