C21H14FN5O2 — CID 118131102
3-[(6-aminopurin-9-yl)methyl]-4-(2-fluorophenyl)isochromen-1-one (PubChem CID 118131102) has the molecular formula C21H14FN5O2 and a molecular weight of 387.37 g/mol. Its IUPAC name is 3-[(6-aminopurin-9-yl)methyl]-4-(2-fluorophenyl)isochromen-1-one.
| Compound Name | 3-[(6-aminopurin-9-yl)methyl]-4-(2-fluorophenyl)isochromen-1-one |
|---|---|
| PubChem CID | 118131102 |
| Molecular Formula | C21H14FN5O2 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[(6-aminopurin-9-yl)methyl]-4-(2-fluorophenyl)isochromen-1-one |
| SMILES | Nc1ncnc2c1ncn2Cc1oc(=O)c2ccccc2c1-c1ccccc1F |
| InChI | InChI=1S/C21H14FN5O2/c22-15-8-4-3-7-14(15)17-12-5-1-2-6-13(12)21(28)29-16(17)9-27-11-26-18-19(23)24-10-25-20(18)27/h1-8,10-11H,9H2,(H2,23,24,25) |
| InChIKey | IYYIHAZHUOTJSK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |