C21H15N5O2 — CID 58269152
2-[(6-aminopurin-9-yl)methyl]-3-phenylchromen-4-one (PubChem CID 58269152) has the molecular formula C21H15N5O2 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-[(6-aminopurin-9-yl)methyl]-3-phenylchromen-4-one.
| Compound Name | 2-[(6-aminopurin-9-yl)methyl]-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 58269152 |
| Molecular Formula | C21H15N5O2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[(6-aminopurin-9-yl)methyl]-3-phenylchromen-4-one |
| SMILES | Nc1ncnc2c1ncn2Cc1oc2ccccc2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C21H15N5O2/c22-20-18-21(24-11-23-20)26(12-25-18)10-16-17(13-6-2-1-3-7-13)19(27)14-8-4-5-9-15(14)28-16/h1-9,11-12H,10H2,(H2,22,23,24) |
| InChIKey | MJUTUKAHFNMZCJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |