C21H24ClFN6O — CID 163345104
6-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-9-(oxolan-2-ylmethyl)purine (PubChem CID 163345104) has the molecular formula C21H24ClFN6O and a molecular weight of 430.92 g/mol. Its IUPAC name is 6-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-9-(oxolan-2-ylmethyl)purine.
| Compound Name | 6-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-9-(oxolan-2-ylmethyl)purine |
|---|---|
| PubChem CID | 163345104 |
| Molecular Formula | C21H24ClFN6O |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 6-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-9-(oxolan-2-ylmethyl)purine |
| SMILES | Fc1cccc(Cl)c1CN1CCN(c2ncnc3c2ncn3CC2CCCO2)CC1 |
| InChI | InChI=1S/C21H24ClFN6O/c22-17-4-1-5-18(23)16(17)12-27-6-8-28(9-7-27)20-19-21(25-13-24-20)29(14-26-19)11-15-3-2-10-30-15/h1,4-5,13-15H,2-3,6-12H2 |
| InChIKey | WMHQCCZOFHSMAW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |