C16H15ClFN5O — CID 155799237
N-(4-chloro-3-fluorophenyl)-9-(oxolan-2-ylmethyl)purin-6-amine (PubChem CID 155799237) has the molecular formula C16H15ClFN5O and a molecular weight of 347.78 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-9-(oxolan-2-ylmethyl)purin-6-amine.
| Compound Name | N-(4-chloro-3-fluorophenyl)-9-(oxolan-2-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 155799237 |
| Molecular Formula | C16H15ClFN5O |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-9-(oxolan-2-ylmethyl)purin-6-amine |
| SMILES | Fc1cc(Nc2ncnc3c2ncn3CC2CCCO2)ccc1Cl |
| InChI | InChI=1S/C16H15ClFN5O/c17-12-4-3-10(6-13(12)18)22-15-14-16(20-8-19-15)23(9-21-14)7-11-2-1-5-24-11/h3-4,6,8-9,11H,1-2,5,7H2,(H,19,20,22) |
| InChIKey | KYWREPDNKHEWHI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |