C22H31N5O — CID 165126933
9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane (PubChem CID 165126933) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane.
| Compound Name | 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane |
|---|---|
| PubChem CID | 165126933 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane |
| SMILES | CCCC1CCCO1.CCc1cccc(Nc2ncnc3c2ncn3CC)c1 |
| InChI | InChI=1S/C15H17N5.C7H14O/c1-3-11-6-5-7-12(8-11)19-14-13-15(17-9-16-14)20(4-2)10-18-13;1-2-4-7-5-3-6-8-7/h5-10H,3-4H2,1-2H3,(H,16,17,19);7H,2-6H2,1H3 |
| InChIKey | ZJEOSVLCOVOAHN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |