About 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane
9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane (PubChem CID 165126933) has the molecular formula C22H31N5O
and a molecular weight of 381.52 g/mol. Its IUPAC name is 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane.
Molecular Properties
| Compound Name | 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane |
| PubChem CID | 165126933 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane |
| SMILES | CCCC1CCCO1.CCc1cccc(Nc2ncnc3c2ncn3CC)c1 |
| InChI | InChI=1S/C15H17N5.C7H14O/c1-3-11-6-5-7-12(8-11)19-14-13-15(17-9-16-14)20(4-2)10-18-13;1-2-4-7-5-3-6-8-7/h5-10H,3-4H2,1-2H3,(H,16,17,19);7H,2-6H2,1H3 |
| InChIKey | ZJEOSVLCOVOAHN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane?
The IUPAC name of 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane (CID 165126933) is 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane.
What is the SMILES notation for 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane?
The canonical SMILES for 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane is CCCC1CCCO1.CCc1cccc(Nc2ncnc3c2ncn3CC)c1.
What is the InChIKey of 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane?
The InChIKey is ZJEOSVLCOVOAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5.C7H14O/c1-3-11-6-5-7-12(8-11)19-14-13-15(17-9-16-14)20(4-2)10-18-13;1-2-4-7-5-3-6-8-7/h5-10H,3-4H2,1-2H3,(H,16,17,19);7H,2-6H2,1H3.
What are the key properties of 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane?
9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane has a molecular weight of 381.52 g/mol, XLogP of 5.12, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-N-(3-ethylphenyl)purin-6-amine;2-propyloxolane is sourced from PubChem (CID 165126933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).