C17H16F3N5O — CID 71578828
9-(oxan-2-yl)-N-[3-(trifluoromethyl)phenyl]purin-6-amine (PubChem CID 71578828) has the molecular formula C17H16F3N5O and a molecular weight of 363.34 g/mol. Its IUPAC name is 9-(oxan-2-yl)-N-[3-(trifluoromethyl)phenyl]purin-6-amine.
| Compound Name | 9-(oxan-2-yl)-N-[3-(trifluoromethyl)phenyl]purin-6-amine |
|---|---|
| PubChem CID | 71578828 |
| Molecular Formula | C17H16F3N5O |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 9-(oxan-2-yl)-N-[3-(trifluoromethyl)phenyl]purin-6-amine |
| SMILES | FC(F)(F)c1cccc(Nc2ncnc3c2ncn3C2CCCCO2)c1 |
| InChI | InChI=1S/C17H16F3N5O/c18-17(19,20)11-4-3-5-12(8-11)24-15-14-16(22-9-21-15)25(10-23-14)13-6-1-2-7-26-13/h3-5,8-10,13H,1-2,6-7H2,(H,21,22,24) |
| InChIKey | DCLCVUZZONRNID-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |