C22H20FN7O2 — CID 71578226
2-fluoro-N-[4-[[9-(oxan-2-yl)purin-6-yl]amino]phenyl]pyridine-3-carboxamide (PubChem CID 71578226) has the molecular formula C22H20FN7O2 and a molecular weight of 433.45 g/mol. Its IUPAC name is 2-fluoro-N-[4-[[9-(oxan-2-yl)purin-6-yl]amino]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[4-[[9-(oxan-2-yl)purin-6-yl]amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71578226 |
| Molecular Formula | C22H20FN7O2 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-fluoro-N-[4-[[9-(oxan-2-yl)purin-6-yl]amino]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ncnc3c2ncn3C2CCCCO2)cc1)c1cccnc1F |
| InChI | InChI=1S/C22H20FN7O2/c23-19-16(4-3-10-24-19)22(31)29-15-8-6-14(7-9-15)28-20-18-21(26-12-25-20)30(13-27-18)17-5-1-2-11-32-17/h3-4,6-10,12-13,17H,1-2,5,11H2,(H,29,31)(H,25,26,28) |
| InChIKey | MZFHHPPRWKKYDZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|