C23H21FN6O3 — CID 164905765
3-fluoro-4-methyl-5-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]benzoic acid (PubChem CID 164905765) has the molecular formula C23H21FN6O3 and a molecular weight of 448.46 g/mol. Its IUPAC name is 3-fluoro-4-methyl-5-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]benzoic acid.
| Compound Name | 3-fluoro-4-methyl-5-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]benzoic acid |
|---|---|
| PubChem CID | 164905765 |
| Molecular Formula | C23H21FN6O3 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-fluoro-4-methyl-5-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]benzoic acid |
| SMILES | Cc1c(F)cc(C(=O)O)cc1Nc1ncccc1-c1ncnc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C23H21FN6O3/c1-13-16(24)9-14(23(31)32)10-17(13)29-21-15(5-4-7-25-21)19-20-22(27-11-26-19)30(12-28-20)18-6-2-3-8-33-18/h4-5,7,9-12,18H,2-3,6,8H2,1H3,(H,25,29)(H,31,32) |
| InChIKey | XKWUFWGUNKBJLF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |