C24H25ClFN7OS — CID 137483393
2-chloro-4-fluoro-3-N-[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]-1-N-propylsulfanylbenzene-1,3-diamine (PubChem CID 137483393) has the molecular formula C24H25ClFN7OS and a molecular weight of 514.03 g/mol. Its IUPAC name is 2-chloro-4-fluoro-3-N-[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]-1-N-propylsulfanylbenzene-1,3-diamine.
| Compound Name | 2-chloro-4-fluoro-3-N-[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]-1-N-propylsulfanylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 137483393 |
| Molecular Formula | C24H25ClFN7OS |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-chloro-4-fluoro-3-N-[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]-1-N-propylsulfanylbenzene-1,3-diamine |
| SMILES | CCCSNc1ccc(F)c(Nc2ncccc2-c2ncnc3c2ncn3C2CCCCO2)c1Cl |
| InChI | InChI=1S/C24H25ClFN7OS/c1-2-12-35-32-17-9-8-16(26)21(19(17)25)31-23-15(6-5-10-27-23)20-22-24(29-13-28-20)33(14-30-22)18-7-3-4-11-34-18/h5-6,8-10,13-14,18,32H,2-4,7,11-12H2,1H3,(H,27,31) |
| InChIKey | QFGALCSHAWGFSD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|