C15H19N7O — CID 154775697
9-ethyl-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]purin-6-amine (PubChem CID 154775697) has the molecular formula C15H19N7O and a molecular weight of 313.37 g/mol. Its IUPAC name is 9-ethyl-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]purin-6-amine.
| Compound Name | 9-ethyl-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 154775697 |
| Molecular Formula | C15H19N7O |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 9-ethyl-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]purin-6-amine |
| SMILES | CCn1cnc2c(Nc3cnn(CC4CCCO4)c3)ncnc21 |
| InChI | InChI=1S/C15H19N7O/c1-2-21-10-18-13-14(16-9-17-15(13)21)20-11-6-19-22(7-11)8-12-4-3-5-23-12/h6-7,9-10,12H,2-5,8H2,1H3,(H,16,17,20) |
| InChIKey | WDRHJWMMGVMTDT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |