C18H21N5O3 — CID 155799333
N-(2,4-dimethoxyphenyl)-9-(oxolan-2-ylmethyl)purin-6-amine (PubChem CID 155799333) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-9-(oxolan-2-ylmethyl)purin-6-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-9-(oxolan-2-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 155799333 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-9-(oxolan-2-ylmethyl)purin-6-amine |
| SMILES | COc1ccc(Nc2ncnc3c2ncn3CC2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C18H21N5O3/c1-24-12-5-6-14(15(8-12)25-2)22-17-16-18(20-10-19-17)23(11-21-16)9-13-4-3-7-26-13/h5-6,8,10-11,13H,3-4,7,9H2,1-2H3,(H,19,20,22) |
| InChIKey | KYGKJWXBARBEBQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |