C12H15N5O — CID 171607061
N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrimidin-2-amine (PubChem CID 171607061) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 171607061 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrimidin-2-amine |
| SMILES | c1cnc(Nc2cnn(CC3CCCO3)c2)nc1 |
| InChI | InChI=1S/C12H15N5O/c1-3-11(18-6-1)9-17-8-10(7-15-17)16-12-13-4-2-5-14-12/h2,4-5,7-8,11H,1,3,6,9H2,(H,13,14,16) |
| InChIKey | RYPBCTLYDITHEY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |