C14H13F2N5O — CID 165433989
N-[3-(difluoromethoxy)phenyl]-9-ethylpurin-6-amine (PubChem CID 165433989) has the molecular formula C14H13F2N5O and a molecular weight of 305.29 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-9-ethylpurin-6-amine.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-9-ethylpurin-6-amine |
|---|---|
| PubChem CID | 165433989 |
| Molecular Formula | C14H13F2N5O |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-9-ethylpurin-6-amine |
| SMILES | CCn1cnc2c(Nc3cccc(OC(F)F)c3)ncnc21 |
| InChI | InChI=1S/C14H13F2N5O/c1-2-21-8-19-11-12(17-7-18-13(11)21)20-9-4-3-5-10(6-9)22-14(15)16/h3-8,14H,2H2,1H3,(H,17,18,20) |
| InChIKey | FUWHCFYDXKAXBW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |