C14H14FN5 — CID 165433816
9-ethyl-N-[(2-fluorophenyl)methyl]purin-6-amine (PubChem CID 165433816) has the molecular formula C14H14FN5 and a molecular weight of 271.30 g/mol. Its IUPAC name is 9-ethyl-N-[(2-fluorophenyl)methyl]purin-6-amine.
| Compound Name | 9-ethyl-N-[(2-fluorophenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 165433816 |
| Molecular Formula | C14H14FN5 |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 9-ethyl-N-[(2-fluorophenyl)methyl]purin-6-amine |
| SMILES | CCn1cnc2c(NCc3ccccc3F)ncnc21 |
| InChI | InChI=1S/C14H14FN5/c1-2-20-9-19-12-13(17-8-18-14(12)20)16-7-10-5-3-4-6-11(10)15/h3-6,8-9H,2,7H2,1H3,(H,16,17,18) |
| InChIKey | QBXHTYKWCZSQGR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |