C15H16FN5O — CID 155799084
N-[(2-fluorophenyl)methyl]-9-(2-methoxyethyl)purin-6-amine (PubChem CID 155799084) has the molecular formula C15H16FN5O and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-9-(2-methoxyethyl)purin-6-amine.
| Compound Name | N-[(2-fluorophenyl)methyl]-9-(2-methoxyethyl)purin-6-amine |
|---|---|
| PubChem CID | 155799084 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-9-(2-methoxyethyl)purin-6-amine |
| SMILES | COCCn1cnc2c(NCc3ccccc3F)ncnc21 |
| InChI | InChI=1S/C15H16FN5O/c1-22-7-6-21-10-20-13-14(18-9-19-15(13)21)17-8-11-4-2-3-5-12(11)16/h2-5,9-10H,6-8H2,1H3,(H,17,18,19) |
| InChIKey | PXBUESAWEVKFIY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |