C15H19FN4O2 — CID 82455571
4-N-[(2-fluorophenyl)methyl]-6-(2-methoxyethoxy)-2-methylpyrimidine-4,5-diamine (PubChem CID 82455571) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-N-[(2-fluorophenyl)methyl]-6-(2-methoxyethoxy)-2-methylpyrimidine-4,5-diamine.
| Compound Name | 4-N-[(2-fluorophenyl)methyl]-6-(2-methoxyethoxy)-2-methylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455571 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-N-[(2-fluorophenyl)methyl]-6-(2-methoxyethoxy)-2-methylpyrimidine-4,5-diamine |
| SMILES | COCCOc1nc(C)nc(NCc2ccccc2F)c1N |
| InChI | InChI=1S/C15H19FN4O2/c1-10-19-14(13(17)15(20-10)22-8-7-21-2)18-9-11-5-3-4-6-12(11)16/h3-6H,7-9,17H2,1-2H3,(H,18,19,20) |
| InChIKey | CEIHWFHFVQTSRZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|