C23H25F4N3O4 — CID 170146152
N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine (PubChem CID 170146152) has the molecular formula C23H25F4N3O4 and a molecular weight of 483.46 g/mol. Its IUPAC name is N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine.
| Compound Name | N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 170146152 |
| Molecular Formula | C23H25F4N3O4 |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine |
| SMILES | COCCOc1cc2nc(C)nc(NCc3cccc(C(F)(F)F)c3F)c2cc1OCCOC |
| InChI | InChI=1S/C23H25F4N3O4/c1-14-29-18-12-20(34-10-8-32-3)19(33-9-7-31-2)11-16(18)22(30-14)28-13-15-5-4-6-17(21(15)24)23(25,26)27/h4-6,11-12H,7-10,13H2,1-3H3,(H,28,29,30) |
| InChIKey | GJPMZRDXTBRITI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|