C24H28F3N3O4 — CID 170146156
N-[[3-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine (PubChem CID 170146156) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-[[3-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine.
| Compound Name | N-[[3-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 170146156 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[[3-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-6,7-bis(2-methoxyethoxy)-2-methylquinazolin-4-amine |
| SMILES | COCCOc1cc2nc(C)nc(NCc3cccc(C(C)(F)F)c3F)c2cc1OCCOC |
| InChI | InChI=1S/C24H28F3N3O4/c1-15-29-19-13-21(34-11-9-32-4)20(33-10-8-31-3)12-17(19)23(30-15)28-14-16-6-5-7-18(22(16)25)24(2,26)27/h5-7,12-13H,8-11,14H2,1-4H3,(H,28,29,30) |
| InChIKey | DCTQXMQGQVOZEM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|