C21H19F6N3O2 — CID 170146165
6-(2-methoxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 170146165) has the molecular formula C21H19F6N3O2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 6-(2-methoxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 170146165 |
| Molecular Formula | C21H19F6N3O2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 6-(2-methoxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | COCCOc1cc2c(NCc3cccc(C(F)(F)F)c3)nc(C)nc2cc1C(F)(F)F |
| InChI | InChI=1S/C21H19F6N3O2/c1-12-29-17-10-16(21(25,26)27)18(32-7-6-31-2)9-15(17)19(30-12)28-11-13-4-3-5-14(8-13)20(22,23)24/h3-5,8-10H,6-7,11H2,1-2H3,(H,28,29,30) |
| InChIKey | XQDJAYBTTIIAPQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|