C21H20F3N3O3 — CID 167153847
5-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-11,14,17-trioxa-4,6-diazatricyclo[8.7.0.03,8]heptadeca-1(10),2,4,6,8-pentaen-7-amine (PubChem CID 167153847) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 5-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-11,14,17-trioxa-4,6-diazatricyclo[8.7.0.03,8]heptadeca-1(10),2,4,6,8-pentaen-7-amine.
| Compound Name | 5-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-11,14,17-trioxa-4,6-diazatricyclo[8.7.0.03,8]heptadeca-1(10),2,4,6,8-pentaen-7-amine |
|---|---|
| PubChem CID | 167153847 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 5-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-11,14,17-trioxa-4,6-diazatricyclo[8.7.0.03,8]heptadeca-1(10),2,4,6,8-pentaen-7-amine |
| SMILES | Cc1nc(NCc2cccc(C(F)(F)F)c2)c2cc3c(cc2n1)OCCOCCO3 |
| InChI | InChI=1S/C21H20F3N3O3/c1-13-26-17-11-19-18(29-7-5-28-6-8-30-19)10-16(17)20(27-13)25-12-14-3-2-4-15(9-14)21(22,23)24/h2-4,9-11H,5-8,12H2,1H3,(H,25,26,27) |
| InChIKey | JPNJSGOKBYOHHQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |