C17H17ClF3N3S — CID 155686412
chloromethane;2,6-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 155686412) has the molecular formula C17H17ClF3N3S and a molecular weight of 387.86 g/mol. Its IUPAC name is chloromethane;2,6-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | chloromethane;2,6-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155686412 |
| Molecular Formula | C17H17ClF3N3S |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | chloromethane;2,6-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCl.Cc1nc(NCc2cccc(C(F)(F)F)c2)c2sc(C)cc2n1 |
| InChI | InChI=1S/C16H14F3N3S.CH3Cl/c1-9-6-13-14(23-9)15(22-10(2)21-13)20-8-11-4-3-5-12(7-11)16(17,18)19;1-2/h3-7H,8H2,1-2H3,(H,20,21,22);1H3 |
| InChIKey | OQKZNFQZEJHQAT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|