C23H21F6N3O2 — CID 170146747
6-(2-cyclopropyloxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 170146747) has the molecular formula C23H21F6N3O2 and a molecular weight of 485.43 g/mol. Its IUPAC name is 6-(2-cyclopropyloxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 6-(2-cyclopropyloxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 170146747 |
| Molecular Formula | C23H21F6N3O2 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 6-(2-cyclopropyloxyethoxy)-2-methyl-7-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | Cc1nc(NCc2cccc(C(F)(F)F)c2)c2cc(OCCOC3CC3)c(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C23H21F6N3O2/c1-13-31-19-11-18(23(27,28)29)20(34-8-7-33-16-5-6-16)10-17(19)21(32-13)30-12-14-3-2-4-15(9-14)22(24,25)26/h2-4,9-11,16H,5-8,12H2,1H3,(H,30,31,32) |
| InChIKey | JHBPJGRAYDMBKW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|