C23H24F3N3O4 — CID 170146381
7-methoxy-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 170146381) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is 7-methoxy-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 7-methoxy-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 170146381 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 7-methoxy-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | COc1cc2nc(C)nc(NCc3cccc(C(F)(F)F)c3)c2cc1OCCOC1COC1 |
| InChI | InChI=1S/C23H24F3N3O4/c1-14-28-19-10-20(30-2)21(33-7-6-32-17-12-31-13-17)9-18(19)22(29-14)27-11-15-4-3-5-16(8-15)23(24,25)26/h3-5,8-10,17H,6-7,11-13H2,1-2H3,(H,27,28,29) |
| InChIKey | GUJOFZFJCQGNMM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|