C20H18F6N4O3 — CID 170146898
7-methoxy-2-methyl-6-[2-(trifluoromethoxy)ethoxy]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]quinazolin-4-amine (PubChem CID 170146898) has the molecular formula C20H18F6N4O3 and a molecular weight of 476.38 g/mol. Its IUPAC name is 7-methoxy-2-methyl-6-[2-(trifluoromethoxy)ethoxy]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]quinazolin-4-amine.
| Compound Name | 7-methoxy-2-methyl-6-[2-(trifluoromethoxy)ethoxy]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 170146898 |
| Molecular Formula | C20H18F6N4O3 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 7-methoxy-2-methyl-6-[2-(trifluoromethoxy)ethoxy]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]quinazolin-4-amine |
| SMILES | COc1cc2nc(C)nc(NCc3cc(C(F)(F)F)ccn3)c2cc1OCCOC(F)(F)F |
| InChI | InChI=1S/C20H18F6N4O3/c1-11-29-15-9-16(31-2)17(32-5-6-33-20(24,25)26)8-14(15)18(30-11)28-10-13-7-12(3-4-27-13)19(21,22)23/h3-4,7-9H,5-6,10H2,1-2H3,(H,28,29,30) |
| InChIKey | DWIBHWRXLLUQCI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|