C22H22F3N3 — CID 69222459
2-cyclohexyl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 69222459) has the molecular formula C22H22F3N3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-cyclohexyl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 2-cyclohexyl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 69222459 |
| Molecular Formula | C22H22F3N3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-cyclohexyl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1cccc(CNc2nc(C3CCCCC3)nc3ccccc23)c1 |
| InChI | InChI=1S/C22H22F3N3/c23-22(24,25)17-10-6-7-15(13-17)14-26-21-18-11-4-5-12-19(18)27-20(28-21)16-8-2-1-3-9-16/h4-7,10-13,16H,1-3,8-9,14H2,(H,26,27,28) |
| InChIKey | KACWPGIKUVURPQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |