C23H19F3N4O2S — CID 42470959
N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]benzenesulfonamide (PubChem CID 42470959) has the molecular formula C23H19F3N4O2S and a molecular weight of 472.49 g/mol. Its IUPAC name is N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42470959 |
| Molecular Formula | C23H19F3N4O2S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1nc(NCc2cccc(C(F)(F)F)c2)c2ccccc2n1)c1ccccc1 |
| InChI | InChI=1S/C23H19F3N4O2S/c24-23(25,26)17-8-6-7-16(13-17)14-27-22-19-11-4-5-12-20(19)29-21(30-22)15-28-33(31,32)18-9-2-1-3-10-18/h1-13,28H,14-15H2,(H,27,29,30) |
| InChIKey | HRUIRRBKDHOGAY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |