C23H17ClF3N5O — CID 26361398
2-chloro-N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]pyridine-4-carboxamide (PubChem CID 26361398) has the molecular formula C23H17ClF3N5O and a molecular weight of 471.87 g/mol. Its IUPAC name is 2-chloro-N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 26361398 |
| Molecular Formula | C23H17ClF3N5O |
| Molecular Weight | 471.87 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 2-chloro-N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1nc(NCc2cccc(C(F)(F)F)c2)c2ccccc2n1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C23H17ClF3N5O/c24-19-11-15(8-9-28-19)22(33)30-13-20-31-18-7-2-1-6-17(18)21(32-20)29-12-14-4-3-5-16(10-14)23(25,26)27/h1-11H,12-13H2,(H,30,33)(H,29,31,32) |
| InChIKey | JVAPTPHVQBCNOI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|