C19H19F3N4O2S — CID 26349972
N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]ethanesulfonamide (PubChem CID 26349972) has the molecular formula C19H19F3N4O2S and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 26349972 |
| Molecular Formula | C19H19F3N4O2S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[[4-[[3-(trifluoromethyl)phenyl]methylamino]quinazolin-2-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1nc(NCc2cccc(C(F)(F)F)c2)c2ccccc2n1 |
| InChI | InChI=1S/C19H19F3N4O2S/c1-2-29(27,28)24-12-17-25-16-9-4-3-8-15(16)18(26-17)23-11-13-6-5-7-14(10-13)19(20,21)22/h3-10,24H,2,11-12H2,1H3,(H,23,25,26) |
| InChIKey | DWMSHRFXRLQDPD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |