C24H19F3N4O — CID 117090190
2-(pyridin-3-ylmethylamino)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide (PubChem CID 117090190) has the molecular formula C24H19F3N4O and a molecular weight of 436.44 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethylamino)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide.
| Compound Name | 2-(pyridin-3-ylmethylamino)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 117090190 |
| Molecular Formula | C24H19F3N4O |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-(pyridin-3-ylmethylamino)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1cc(NCc2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C24H19F3N4O/c25-24(26,27)18-7-3-5-16(11-18)14-30-23(32)20-12-22(29-15-17-6-4-10-28-13-17)31-21-9-2-1-8-19(20)21/h1-13H,14-15H2,(H,29,31)(H,30,32) |
| InChIKey | SODJISSDWNVVGL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |