C18H13F3N4O — CID 134539241
[6-(pyridin-3-ylmethylamino)pyridazin-3-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 134539241) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is [6-(pyridin-3-ylmethylamino)pyridazin-3-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [6-(pyridin-3-ylmethylamino)pyridazin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 134539241 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [6-(pyridin-3-ylmethylamino)pyridazin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)c1ccc(NCc2cccnc2)nn1 |
| InChI | InChI=1S/C18H13F3N4O/c19-18(20,21)14-5-1-4-13(9-14)17(26)15-6-7-16(25-24-15)23-11-12-3-2-8-22-10-12/h1-10H,11H2,(H,23,25) |
| InChIKey | WEPYTGWKPDMZGJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |