C15H16BrN5O — CID 155799369
N-(4-bromo-3-methylphenyl)-9-(2-methoxyethyl)purin-6-amine (PubChem CID 155799369) has the molecular formula C15H16BrN5O and a molecular weight of 362.23 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-9-(2-methoxyethyl)purin-6-amine.
| Compound Name | N-(4-bromo-3-methylphenyl)-9-(2-methoxyethyl)purin-6-amine |
|---|---|
| PubChem CID | 155799369 |
| Molecular Formula | C15H16BrN5O |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-9-(2-methoxyethyl)purin-6-amine |
| SMILES | COCCn1cnc2c(Nc3ccc(Br)c(C)c3)ncnc21 |
| InChI | InChI=1S/C15H16BrN5O/c1-10-7-11(3-4-12(10)16)20-14-13-15(18-8-17-14)21(9-19-13)5-6-22-2/h3-4,7-9H,5-6H2,1-2H3,(H,17,18,20) |
| InChIKey | KIAXQWOBJXCFDR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |