C15H17FN6 — CID 18440348
9-ethyl-2-N-[2-(2-fluorophenyl)ethyl]purine-2,6-diamine (PubChem CID 18440348) has the molecular formula C15H17FN6 and a molecular weight of 300.34 g/mol. Its IUPAC name is 9-ethyl-2-N-[2-(2-fluorophenyl)ethyl]purine-2,6-diamine.
| Compound Name | 9-ethyl-2-N-[2-(2-fluorophenyl)ethyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 18440348 |
| Molecular Formula | C15H17FN6 |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 9-ethyl-2-N-[2-(2-fluorophenyl)ethyl]purine-2,6-diamine |
| SMILES | CCn1cnc2c(N)nc(NCCc3ccccc3F)nc21 |
| InChI | InChI=1S/C15H17FN6/c1-2-22-9-19-12-13(17)20-15(21-14(12)22)18-8-7-10-5-3-4-6-11(10)16/h3-6,9H,2,7-8H2,1H3,(H3,17,18,20,21) |
| InChIKey | NBDLRRDZIGGZJH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |