C15H17N5O — CID 18440387
9-ethyl-2-(2-phenylethoxy)purin-6-amine (PubChem CID 18440387) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is 9-ethyl-2-(2-phenylethoxy)purin-6-amine.
| Compound Name | 9-ethyl-2-(2-phenylethoxy)purin-6-amine |
|---|---|
| PubChem CID | 18440387 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 9-ethyl-2-(2-phenylethoxy)purin-6-amine |
| SMILES | CCn1cnc2c(N)nc(OCCc3ccccc3)nc21 |
| InChI | InChI=1S/C15H17N5O/c1-2-20-10-17-12-13(16)18-15(19-14(12)20)21-9-8-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3,(H2,16,18,19) |
| InChIKey | UKELFVAQHJENMY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |