C20H24BrN5O — CID 69337041
8-bromo-9-hept-4-enyl-2-(2-phenylethoxy)purin-6-amine (PubChem CID 69337041) has the molecular formula C20H24BrN5O and a molecular weight of 430.35 g/mol. Its IUPAC name is 8-bromo-9-hept-4-enyl-2-(2-phenylethoxy)purin-6-amine.
| Compound Name | 8-bromo-9-hept-4-enyl-2-(2-phenylethoxy)purin-6-amine |
|---|---|
| PubChem CID | 69337041 |
| Molecular Formula | C20H24BrN5O |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 8-bromo-9-hept-4-enyl-2-(2-phenylethoxy)purin-6-amine |
| SMILES | CCC=CCCCn1c(Br)nc2c(N)nc(OCCc3ccccc3)nc21 |
| InChI | InChI=1S/C20H24BrN5O/c1-2-3-4-5-9-13-26-18-16(23-19(26)21)17(22)24-20(25-18)27-14-12-15-10-7-6-8-11-15/h3-4,6-8,10-11H,2,5,9,12-14H2,1H3,(H2,22,24,25) |
| InChIKey | ZZHYSVBWBZCSJZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|