C15H16BrClN6O — CID 22928913
8-bromo-2-butoxy-9-[(6-chloro-3-pyridinyl)methyl]purin-6-amine (PubChem CID 22928913) has the molecular formula C15H16BrClN6O and a molecular weight of 411.69 g/mol. Its IUPAC name is 8-bromo-2-butoxy-9-[(6-chloro-3-pyridinyl)methyl]purin-6-amine.
| Compound Name | 8-bromo-2-butoxy-9-[(6-chloro-3-pyridinyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 22928913 |
| Molecular Formula | C15H16BrClN6O |
| Molecular Weight | 411.69 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 8-bromo-2-butoxy-9-[(6-chloro-3-pyridinyl)methyl]purin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(Br)n(Cc3ccc(Cl)nc3)c2n1 |
| InChI | InChI=1S/C15H16BrClN6O/c1-2-3-6-24-15-21-12(18)11-13(22-15)23(14(16)20-11)8-9-4-5-10(17)19-7-9/h4-5,7H,2-3,6,8H2,1H3,(H2,18,21,22) |
| InChIKey | SWWJPZKLRFNHAJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|