C19H25N5O2 — CID 118517991
9-benzyl-2-butoxy-8-(ethoxymethyl)purin-6-amine (PubChem CID 118517991) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 9-benzyl-2-butoxy-8-(ethoxymethyl)purin-6-amine.
| Compound Name | 9-benzyl-2-butoxy-8-(ethoxymethyl)purin-6-amine |
|---|---|
| PubChem CID | 118517991 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 9-benzyl-2-butoxy-8-(ethoxymethyl)purin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(COCC)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C19H25N5O2/c1-3-5-11-26-19-22-17(20)16-18(23-19)24(15(21-16)13-25-4-2)12-14-9-7-6-8-10-14/h6-10H,3-5,11-13H2,1-2H3,(H2,20,22,23) |
| InChIKey | VEDKFJBZPPUBEQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|