C13H12BrN5O — CID 11099680
9-benzyl-8-bromo-2-methoxypurin-6-amine (PubChem CID 11099680) has the molecular formula C13H12BrN5O and a molecular weight of 334.18 g/mol. Its IUPAC name is 9-benzyl-8-bromo-2-methoxypurin-6-amine.
| Compound Name | 9-benzyl-8-bromo-2-methoxypurin-6-amine |
|---|---|
| PubChem CID | 11099680 |
| Molecular Formula | C13H12BrN5O |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 9-benzyl-8-bromo-2-methoxypurin-6-amine |
| SMILES | COc1nc(N)c2nc(Br)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C13H12BrN5O/c1-20-13-17-10(15)9-11(18-13)19(12(14)16-9)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,15,17,18) |
| InChIKey | YOAVRVROSBQHTC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |